C14H17ClN2O2 — CID 104511734
4-tert-butyl-1-(4-chloropyridine-2-carbonyl)pyrrolidin-2-one (PubChem CID 104511734) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is 4-tert-butyl-1-(4-chloropyridine-2-carbonyl)pyrrolidin-2-one.
| Compound Name | 4-tert-butyl-1-(4-chloropyridine-2-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 104511734 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-tert-butyl-1-(4-chloropyridine-2-carbonyl)pyrrolidin-2-one |
| SMILES | CC(C)(C)C1CC(=O)N(C(=O)c2cc(Cl)ccn2)C1 |
| InChI | InChI=1S/C14H17ClN2O2/c1-14(2,3)9-6-12(18)17(8-9)13(19)11-7-10(15)4-5-16-11/h4-5,7,9H,6,8H2,1-3H3 |
| InChIKey | BFTAGMMHLMEJOG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|