About 4-tert-butyl-1-(3,4,5-trifluorobenzoyl)pyrrolidin-2-one
4-tert-butyl-1-(3,4,5-trifluorobenzoyl)pyrrolidin-2-one (PubChem CID 104511745) has the molecular formula C15H16F3NO2
and a molecular weight of 299.29 g/mol. Its IUPAC name is 4-tert-butyl-1-(3,4,5-trifluorobenzoyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-tert-butyl-1-(3,4,5-trifluorobenzoyl)pyrrolidin-2-one |
| PubChem CID | 104511745 |
| Molecular Formula | C15H16F3NO2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 4-tert-butyl-1-(3,4,5-trifluorobenzoyl)pyrrolidin-2-one |
| SMILES | CC(C)(C)C1CC(=O)N(C(=O)c2cc(F)c(F)c(F)c2)C1 |
| InChI | InChI=1S/C15H16F3NO2/c1-15(2,3)9-6-12(20)19(7-9)14(21)8-4-10(16)13(18)11(17)5-8/h4-5,9H,6-7H2,1-3H3 |
| InChIKey | WVYHJEWOJFAQQQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-1-(3,4,5-trifluorobenzoyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1-(3,4,5-trifluorobenzoyl)pyrrolidin-2-one?
The IUPAC name of 4-tert-butyl-1-(3,4,5-trifluorobenzoyl)pyrrolidin-2-one (CID 104511745) is 4-tert-butyl-1-(3,4,5-trifluorobenzoyl)pyrrolidin-2-one.
What is the SMILES notation for 4-tert-butyl-1-(3,4,5-trifluorobenzoyl)pyrrolidin-2-one?
The canonical SMILES for 4-tert-butyl-1-(3,4,5-trifluorobenzoyl)pyrrolidin-2-one is CC(C)(C)C1CC(=O)N(C(=O)c2cc(F)c(F)c(F)c2)C1.
What is the InChIKey of 4-tert-butyl-1-(3,4,5-trifluorobenzoyl)pyrrolidin-2-one?
The InChIKey is WVYHJEWOJFAQQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F3NO2/c1-15(2,3)9-6-12(20)19(7-9)14(21)8-4-10(16)13(18)11(17)5-8/h4-5,9H,6-7H2,1-3H3.
What are the key properties of 4-tert-butyl-1-(3,4,5-trifluorobenzoyl)pyrrolidin-2-one?
4-tert-butyl-1-(3,4,5-trifluorobenzoyl)pyrrolidin-2-one has a molecular weight of 299.29 g/mol, XLogP of 3.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1-(3,4,5-trifluorobenzoyl)pyrrolidin-2-one is sourced from PubChem (CID 104511745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).