C21H13ClN2O2 — CID 10451184
4-[8-(3-chlorophenyl)-1,7-naphthyridin-6-yl]benzoic acid (PubChem CID 10451184) has the molecular formula C21H13ClN2O2 and a molecular weight of 360.80 g/mol. Its IUPAC name is 4-[8-(3-chlorophenyl)-1,7-naphthyridin-6-yl]benzoic acid.
| Compound Name | 4-[8-(3-chlorophenyl)-1,7-naphthyridin-6-yl]benzoic acid |
|---|---|
| PubChem CID | 10451184 |
| Molecular Formula | C21H13ClN2O2 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 4-[8-(3-chlorophenyl)-1,7-naphthyridin-6-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cc3cccnc3c(-c3cccc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C21H13ClN2O2/c22-17-5-1-3-15(11-17)20-19-16(4-2-10-23-19)12-18(24-20)13-6-8-14(9-7-13)21(25)26/h1-12H,(H,25,26) |
| InChIKey | WYEOCWCFOOXSMR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |