C15H19FN2OS — CID 104511879
3-fluoro-5-[(2-oxo-4-propylpyrrolidin-1-yl)methyl]benzenecarbothioamide (PubChem CID 104511879) has the molecular formula C15H19FN2OS and a molecular weight of 294.40 g/mol. Its IUPAC name is 3-fluoro-5-[(2-oxo-4-propylpyrrolidin-1-yl)methyl]benzenecarbothioamide.
| Compound Name | 3-fluoro-5-[(2-oxo-4-propylpyrrolidin-1-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 104511879 |
| Molecular Formula | C15H19FN2OS |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3-fluoro-5-[(2-oxo-4-propylpyrrolidin-1-yl)methyl]benzenecarbothioamide |
| SMILES | CCCC1CC(=O)N(Cc2cc(F)cc(C(N)=S)c2)C1 |
| InChI | InChI=1S/C15H19FN2OS/c1-2-3-10-6-14(19)18(8-10)9-11-4-12(15(17)20)7-13(16)5-11/h4-5,7,10H,2-3,6,8-9H2,1H3,(H2,17,20) |
| InChIKey | UHECDMMDSNHWNZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|