C8H9N5O2 — CID 104515213
(3-methoxypyrazin-2-yl)-(2H-triazol-4-yl)methanol (PubChem CID 104515213) has the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. Its IUPAC name is (3-methoxypyrazin-2-yl)-(2H-triazol-4-yl)methanol.
| Compound Name | (3-methoxypyrazin-2-yl)-(2H-triazol-4-yl)methanol |
|---|---|
| PubChem CID | 104515213 |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | (3-methoxypyrazin-2-yl)-(2H-triazol-4-yl)methanol |
| SMILES | COc1nccnc1C(O)c1cn[nH]n1 |
| InChI | InChI=1S/C8H9N5O2/c1-15-8-6(9-2-3-10-8)7(14)5-4-11-13-12-5/h2-4,7,14H,1H3,(H,11,12,13) |
| InChIKey | ZAECWEODPAADTK-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |