C19H29NO4S — CID 10451622
tert-butyl 2-[[(E)-5-(furan-2-yl)-3-oxopent-4-enyl]amino]-5-methylsulfanylpentanoate (PubChem CID 10451622) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is tert-butyl 2-[[(E)-5-(furan-2-yl)-3-oxopent-4-enyl]amino]-5-methylsulfanylpentanoate.
| Compound Name | tert-butyl 2-[[(E)-5-(furan-2-yl)-3-oxopent-4-enyl]amino]-5-methylsulfanylpentanoate |
|---|---|
| PubChem CID | 10451622 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | tert-butyl 2-[[(E)-5-(furan-2-yl)-3-oxopent-4-enyl]amino]-5-methylsulfanylpentanoate |
| SMILES | CSCCCC(NCCC(=O)/C=C/c1ccco1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29NO4S/c1-19(2,3)24-18(22)17(8-6-14-25-4)20-12-11-15(21)9-10-16-7-5-13-23-16/h5,7,9-10,13,17,20H,6,8,11-12,14H2,1-4H3/b10-9+ |
| InChIKey | QKMQPRKFPCWZMH-MDZDMXLPSA-N |
| XLogP | 3.70 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|