C10H14F3N3O2 — CID 104516351
3-amino-1,1,1-trifluoro-2-(3-methoxypyrazin-2-yl)pentan-2-ol (PubChem CID 104516351) has the molecular formula C10H14F3N3O2 and a molecular weight of 265.24 g/mol. Its IUPAC name is 3-amino-1,1,1-trifluoro-2-(3-methoxypyrazin-2-yl)pentan-2-ol.
| Compound Name | 3-amino-1,1,1-trifluoro-2-(3-methoxypyrazin-2-yl)pentan-2-ol |
|---|---|
| PubChem CID | 104516351 |
| Molecular Formula | C10H14F3N3O2 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 3-amino-1,1,1-trifluoro-2-(3-methoxypyrazin-2-yl)pentan-2-ol |
| SMILES | CCC(N)C(O)(c1nccnc1OC)C(F)(F)F |
| InChI | InChI=1S/C10H14F3N3O2/c1-3-6(14)9(17,10(11,12)13)7-8(18-2)16-5-4-15-7/h4-6,17H,3,14H2,1-2H3 |
| InChIKey | NQKBOSLIXVPCRH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |