C12H19BrN2O — CID 104516492
2-(3-bromo-4,4-dimethylpentyl)-3-methoxypyrazine (PubChem CID 104516492) has the molecular formula C12H19BrN2O and a molecular weight of 287.20 g/mol. Its IUPAC name is 2-(3-bromo-4,4-dimethylpentyl)-3-methoxypyrazine.
| Compound Name | 2-(3-bromo-4,4-dimethylpentyl)-3-methoxypyrazine |
|---|---|
| PubChem CID | 104516492 |
| Molecular Formula | C12H19BrN2O |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-(3-bromo-4,4-dimethylpentyl)-3-methoxypyrazine |
| SMILES | COc1nccnc1CCC(Br)C(C)(C)C |
| InChI | InChI=1S/C12H19BrN2O/c1-12(2,3)10(13)6-5-9-11(16-4)15-8-7-14-9/h7-8,10H,5-6H2,1-4H3 |
| InChIKey | ZQWFAPRINDULQF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|