C13H21N3O — CID 104516737
(E)-4-(3-methoxypyrazin-2-yl)-N-(2-methylpropyl)but-3-en-1-amine (PubChem CID 104516737) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is (E)-4-(3-methoxypyrazin-2-yl)-N-(2-methylpropyl)but-3-en-1-amine.
| Compound Name | (E)-4-(3-methoxypyrazin-2-yl)-N-(2-methylpropyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 104516737 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | (E)-4-(3-methoxypyrazin-2-yl)-N-(2-methylpropyl)but-3-en-1-amine |
| SMILES | COc1nccnc1/C=C/CCNCC(C)C |
| InChI | InChI=1S/C13H21N3O/c1-11(2)10-14-7-5-4-6-12-13(17-3)16-9-8-15-12/h4,6,8-9,11,14H,5,7,10H2,1-3H3/b6-4+ |
| InChIKey | DCSCIDQWTPNBCV-GQCTYLIASA-N |
| XLogP | 2.13 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|