About 2-[3-(1,3-benzodioxol-5-yl)-4-pyridinyl]-3-cyclopentyl-1,3-thiazolidin-4-one
2-[3-(1,3-benzodioxol-5-yl)-4-pyridinyl]-3-cyclopentyl-1,3-thiazolidin-4-one (PubChem CID 10451674) has the molecular formula C20H20N2O3S
and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-[3-(1,3-benzodioxol-5-yl)-4-pyridinyl]-3-cyclopentyl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-[3-(1,3-benzodioxol-5-yl)-4-pyridinyl]-3-cyclopentyl-1,3-thiazolidin-4-one |
| PubChem CID | 10451674 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-[3-(1,3-benzodioxol-5-yl)-4-pyridinyl]-3-cyclopentyl-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccncc2-c2ccc3c(c2)OCO3)N1C1CCCC1 |
| InChI | InChI=1S/C20H20N2O3S/c23-19-11-26-20(22(19)14-3-1-2-4-14)15-7-8-21-10-16(15)13-5-6-17-18(9-13)25-12-24-17/h5-10,14,20H,1-4,11-12H2 |
| InChIKey | GWPDCWRVLNQTDM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-(1,3-benzodioxol-5-yl)-4-pyridinyl]-3-cyclopentyl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1,3-benzodioxol-5-yl)-4-pyridinyl]-3-cyclopentyl-1,3-thiazolidin-4-one?
The IUPAC name of 2-[3-(1,3-benzodioxol-5-yl)-4-pyridinyl]-3-cyclopentyl-1,3-thiazolidin-4-one (CID 10451674) is 2-[3-(1,3-benzodioxol-5-yl)-4-pyridinyl]-3-cyclopentyl-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-[3-(1,3-benzodioxol-5-yl)-4-pyridinyl]-3-cyclopentyl-1,3-thiazolidin-4-one?
The canonical SMILES for 2-[3-(1,3-benzodioxol-5-yl)-4-pyridinyl]-3-cyclopentyl-1,3-thiazolidin-4-one is O=C1CSC(c2ccncc2-c2ccc3c(c2)OCO3)N1C1CCCC1.
What is the InChIKey of 2-[3-(1,3-benzodioxol-5-yl)-4-pyridinyl]-3-cyclopentyl-1,3-thiazolidin-4-one?
The InChIKey is GWPDCWRVLNQTDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O3S/c23-19-11-26-20(22(19)14-3-1-2-4-14)15-7-8-21-10-16(15)13-5-6-17-18(9-13)25-12-24-17/h5-10,14,20H,1-4,11-12H2.
What are the key properties of 2-[3-(1,3-benzodioxol-5-yl)-4-pyridinyl]-3-cyclopentyl-1,3-thiazolidin-4-one?
2-[3-(1,3-benzodioxol-5-yl)-4-pyridinyl]-3-cyclopentyl-1,3-thiazolidin-4-one has a molecular weight of 368.46 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1,3-benzodioxol-5-yl)-4-pyridinyl]-3-cyclopentyl-1,3-thiazolidin-4-one is sourced from PubChem (CID 10451674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).