C12H16N2O3 — CID 104516749
2-(3-methoxypyrazin-2-yl)cyclohexane-1-carboxylic acid (PubChem CID 104516749) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-(3-methoxypyrazin-2-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 2-(3-methoxypyrazin-2-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 104516749 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-(3-methoxypyrazin-2-yl)cyclohexane-1-carboxylic acid |
| SMILES | COc1nccnc1C1CCCCC1C(=O)O |
| InChI | InChI=1S/C12H16N2O3/c1-17-11-10(13-6-7-14-11)8-4-2-3-5-9(8)12(15)16/h6-9H,2-5H2,1H3,(H,15,16) |
| InChIKey | MAJZSBXGONGDIX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |