C12H21NO6S — CID 104517631
3-[1-(2-methylsulfonylpropanoyl)piperidin-4-yl]oxypropanoic acid (PubChem CID 104517631) has the molecular formula C12H21NO6S and a molecular weight of 307.37 g/mol. Its IUPAC name is 3-[1-(2-methylsulfonylpropanoyl)piperidin-4-yl]oxypropanoic acid.
| Compound Name | 3-[1-(2-methylsulfonylpropanoyl)piperidin-4-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 104517631 |
| Molecular Formula | C12H21NO6S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 3-[1-(2-methylsulfonylpropanoyl)piperidin-4-yl]oxypropanoic acid |
| SMILES | CC(C(=O)N1CCC(OCCC(=O)O)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C12H21NO6S/c1-9(20(2,17)18)12(16)13-6-3-10(4-7-13)19-8-5-11(14)15/h9-10H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | RDTAWFCCIZALHW-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |