C13H17N4O7P — CID 10451888
[(1R)-1-[ethyl-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]ethyl]phosphonic acid (PubChem CID 10451888) has the molecular formula C13H17N4O7P and a molecular weight of 372.27 g/mol. Its IUPAC name is [(1R)-1-[ethyl-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]ethyl]phosphonic acid.
| Compound Name | [(1R)-1-[ethyl-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 10451888 |
| Molecular Formula | C13H17N4O7P |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | [(1R)-1-[ethyl-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]ethyl]phosphonic acid |
| SMILES | CCN(Cc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12)[C@@H](C)P(=O)(O)O |
| InChI | InChI=1S/C13H17N4O7P/c1-3-16(7(2)25(22,23)24)6-8-4-9(17(20)21)5-10-11(8)15-13(19)12(18)14-10/h4-5,7H,3,6H2,1-2H3,(H,14,18)(H,15,19)(H2,22,23,24)/t7-/m1/s1 |
| InChIKey | WOAGSQCIFSCNIH-SSDOTTSWSA-N |
| XLogP | 0.47 |
| TPSA | 169.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|