About 2-methylsulfonyl-1-(2,4,6-triethylphenyl)propan-1-amine
2-methylsulfonyl-1-(2,4,6-triethylphenyl)propan-1-amine (PubChem CID 104519089) has the molecular formula C16H27NO2S
and a molecular weight of 297.46 g/mol. Its IUPAC name is 2-methylsulfonyl-1-(2,4,6-triethylphenyl)propan-1-amine.
Molecular Properties
| Compound Name | 2-methylsulfonyl-1-(2,4,6-triethylphenyl)propan-1-amine |
| PubChem CID | 104519089 |
| Molecular Formula | C16H27NO2S |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 2-methylsulfonyl-1-(2,4,6-triethylphenyl)propan-1-amine |
| SMILES | CCc1cc(CC)c(C(N)C(C)S(C)(=O)=O)c(CC)c1 |
| InChI | InChI=1S/C16H27NO2S/c1-6-12-9-13(7-2)15(14(8-3)10-12)16(17)11(4)20(5,18)19/h9-11,16H,6-8,17H2,1-5H3 |
| InChIKey | MPYNEFLCWNFNHW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylsulfonyl-1-(2,4,6-triethylphenyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfonyl-1-(2,4,6-triethylphenyl)propan-1-amine?
The IUPAC name of 2-methylsulfonyl-1-(2,4,6-triethylphenyl)propan-1-amine (CID 104519089) is 2-methylsulfonyl-1-(2,4,6-triethylphenyl)propan-1-amine.
What is the SMILES notation for 2-methylsulfonyl-1-(2,4,6-triethylphenyl)propan-1-amine?
The canonical SMILES for 2-methylsulfonyl-1-(2,4,6-triethylphenyl)propan-1-amine is CCc1cc(CC)c(C(N)C(C)S(C)(=O)=O)c(CC)c1.
What is the InChIKey of 2-methylsulfonyl-1-(2,4,6-triethylphenyl)propan-1-amine?
The InChIKey is MPYNEFLCWNFNHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO2S/c1-6-12-9-13(7-2)15(14(8-3)10-12)16(17)11(4)20(5,18)19/h9-11,16H,6-8,17H2,1-5H3.
What are the key properties of 2-methylsulfonyl-1-(2,4,6-triethylphenyl)propan-1-amine?
2-methylsulfonyl-1-(2,4,6-triethylphenyl)propan-1-amine has a molecular weight of 297.46 g/mol, XLogP of 2.81, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfonyl-1-(2,4,6-triethylphenyl)propan-1-amine is sourced from PubChem (CID 104519089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).