C19H20N2O4S — CID 10451914
(1R,2S,10R)-13-hydroxy-19-methyl-11-oxa-6-thia-3,19-diazahexacyclo[10.9.1.01,10.02,7.02,18.016,22]docosa-12,14,16(22)-triene-4,9-dione (PubChem CID 10451914) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is (1R,2S,10R)-13-hydroxy-19-methyl-11-oxa-6-thia-3,19-diazahexacyclo[10.9.1.01,10.02,7.02,18.016,22]docosa-12,14,16(22)-triene-4,9-dione.
| Compound Name | (1R,2S,10R)-13-hydroxy-19-methyl-11-oxa-6-thia-3,19-diazahexacyclo[10.9.1.01,10.02,7.02,18.016,22]docosa-12,14,16(22)-triene-4,9-dione |
|---|---|
| PubChem CID | 10451914 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (1R,2S,10R)-13-hydroxy-19-methyl-11-oxa-6-thia-3,19-diazahexacyclo[10.9.1.01,10.02,7.02,18.016,22]docosa-12,14,16(22)-triene-4,9-dione |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(=O)CC2SCC(=O)N[C@@]23C1C5 |
| InChI | InChI=1S/C19H20N2O4S/c1-21-5-4-18-15-9-2-3-10(22)16(15)25-17(18)11(23)7-13-19(18,12(21)6-9)20-14(24)8-26-13/h2-3,12-13,17,22H,4-8H2,1H3,(H,20,24)/t12?,13?,17-,18-,19-/m0/s1 |
| InChIKey | VLJKPFPAYFHINO-FGSMPNOLSA-N |
| XLogP | 0.59 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |