C11H14N4O2S — CID 104519732
5-(1-methylsulfonylethyl)-4-pyridin-4-yl-1H-pyrazol-3-amine (PubChem CID 104519732) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 5-(1-methylsulfonylethyl)-4-pyridin-4-yl-1H-pyrazol-3-amine.
| Compound Name | 5-(1-methylsulfonylethyl)-4-pyridin-4-yl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 104519732 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 5-(1-methylsulfonylethyl)-4-pyridin-4-yl-1H-pyrazol-3-amine |
| SMILES | CC(c1[nH]nc(N)c1-c1ccncc1)S(C)(=O)=O |
| InChI | InChI=1S/C11H14N4O2S/c1-7(18(2,16)17)10-9(11(12)15-14-10)8-3-5-13-6-4-8/h3-7H,1-2H3,(H3,12,14,15) |
| InChIKey | SRJPUUAAYNNAGH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |