C24H25NO3 — CID 10452108
4-[2-[(5R)-2-oxo-5-[(1E,3E)-4-phenylpenta-1,3-dienyl]pyrrolidin-1-yl]ethyl]benzoic acid (PubChem CID 10452108) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-[2-[(5R)-2-oxo-5-[(1E,3E)-4-phenylpenta-1,3-dienyl]pyrrolidin-1-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(5R)-2-oxo-5-[(1E,3E)-4-phenylpenta-1,3-dienyl]pyrrolidin-1-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 10452108 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 4-[2-[(5R)-2-oxo-5-[(1E,3E)-4-phenylpenta-1,3-dienyl]pyrrolidin-1-yl]ethyl]benzoic acid |
| SMILES | C/C(=C\C=C\[C@H]1CCC(=O)N1CCc1ccc(C(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H25NO3/c1-18(20-7-3-2-4-8-20)6-5-9-22-14-15-23(26)25(22)17-16-19-10-12-21(13-11-19)24(27)28/h2-13,22H,14-17H2,1H3,(H,27,28)/b9-5+,18-6+/t22-/m0/s1 |
| InChIKey | OVWCEHQXEOKSBR-IZJUNRQYSA-N |
| XLogP | 4.58 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|