C10H15NO3S — CID 104521192
(1,1-dioxothian-2-yl)-(1H-pyrrol-2-yl)methanol (PubChem CID 104521192) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is (1,1-dioxothian-2-yl)-(1H-pyrrol-2-yl)methanol.
| Compound Name | (1,1-dioxothian-2-yl)-(1H-pyrrol-2-yl)methanol |
|---|---|
| PubChem CID | 104521192 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | (1,1-dioxothian-2-yl)-(1H-pyrrol-2-yl)methanol |
| SMILES | O=S1(=O)CCCCC1C(O)c1ccc[nH]1 |
| InChI | InChI=1S/C10H15NO3S/c12-10(8-4-3-6-11-8)9-5-1-2-7-15(9,13)14/h3-4,6,9-12H,1-2,5,7H2 |
| InChIKey | IQCGNBSQMKCARK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |