C17H28O9 — CID 10452146
(3aR,5R,6S,6aR)-5-[[(2R,4R,5S,6R)-4-hydroxy-6-(hydroxymethyl)-5-(methoxymethoxy)-3-methylideneoxan-2-yl]methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 10452146) has the molecular formula C17H28O9 and a molecular weight of 376.40 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-[[(2R,4R,5S,6R)-4-hydroxy-6-(hydroxymethyl)-5-(methoxymethoxy)-3-methylideneoxan-2-yl]methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5R,6S,6aR)-5-[[(2R,4R,5S,6R)-4-hydroxy-6-(hydroxymethyl)-5-(methoxymethoxy)-3-methylideneoxan-2-yl]methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 10452146 |
| Molecular Formula | C17H28O9 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-[[(2R,4R,5S,6R)-4-hydroxy-6-(hydroxymethyl)-5-(methoxymethoxy)-3-methylideneoxan-2-yl]methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | C=C1[C@@H](O)[C@H](OCOC)[C@@H](CO)O[C@@H]1C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C17H28O9/c1-8-9(23-11(6-18)14(12(8)19)22-7-21-4)5-10-13(20)15-16(24-10)26-17(2,3)25-15/h9-16,18-20H,1,5-7H2,2-4H3/t9-,10-,11-,12-,13+,14-,15-,16-/m1/s1 |
| InChIKey | VTGRQJXFBVMOPH-QYOWUKMRSA-N |
| XLogP | -0.72 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|