C24H28N2O2 — CID 10452166
9-(4,5-diphenylpyrazol-1-yl)nonanoic acid (PubChem CID 10452166) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 9-(4,5-diphenylpyrazol-1-yl)nonanoic acid.
| Compound Name | 9-(4,5-diphenylpyrazol-1-yl)nonanoic acid |
|---|---|
| PubChem CID | 10452166 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 9-(4,5-diphenylpyrazol-1-yl)nonanoic acid |
| SMILES | O=C(O)CCCCCCCCn1ncc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C24H28N2O2/c27-23(28)17-11-3-1-2-4-12-18-26-24(21-15-9-6-10-16-21)22(19-25-26)20-13-7-5-8-14-20/h5-10,13-16,19H,1-4,11-12,17-18H2,(H,27,28) |
| InChIKey | NYSUVLRXICSMFG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|