C16H13N5O3S — CID 10452183
(5R,6Z)-6-[(7-methyl-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 10452183) has the molecular formula C16H13N5O3S and a molecular weight of 355.38 g/mol. Its IUPAC name is (5R,6Z)-6-[(7-methyl-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6Z)-6-[(7-methyl-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 10452183 |
| Molecular Formula | C16H13N5O3S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | (5R,6Z)-6-[(7-methyl-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | Cc1nc2nc(/C=C3/C(=O)N4C(C(=O)O)=CS[C@H]34)nn2c2c1CCC2 |
| InChI | InChI=1S/C16H13N5O3S/c1-7-8-3-2-4-10(8)21-16(17-7)18-12(19-21)5-9-13(22)20-11(15(23)24)6-25-14(9)20/h5-6,14H,2-4H2,1H3,(H,23,24)/b9-5-/t14-/m1/s1 |
| InChIKey | GVIJNDBUPIEBNV-VYLZPFMQSA-N |
| XLogP | 1.15 |
| TPSA | 100.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|