C9H19N3O2S — CID 104521937
N-amino-1,1-dioxo-N'-propan-2-ylthiane-2-carboximidamide (PubChem CID 104521937) has the molecular formula C9H19N3O2S and a molecular weight of 233.34 g/mol. Its IUPAC name is N-amino-1,1-dioxo-N'-propan-2-ylthiane-2-carboximidamide.
| Compound Name | N-amino-1,1-dioxo-N'-propan-2-ylthiane-2-carboximidamide |
|---|---|
| PubChem CID | 104521937 |
| Molecular Formula | C9H19N3O2S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-amino-1,1-dioxo-N'-propan-2-ylthiane-2-carboximidamide |
| SMILES | CC(C)/N=C(\NN)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C9H19N3O2S/c1-7(2)11-9(12-10)8-5-3-4-6-15(8,13)14/h7-8H,3-6,10H2,1-2H3,(H,11,12) |
| InChIKey | JAGGCUZUPMXMEJ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|