About 2-methyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrrole
2-methyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrrole (PubChem CID 10452199) has the molecular formula C24H18F3N
and a molecular weight of 377.41 g/mol. Its IUPAC name is 2-methyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrrole.
Molecular Properties
| Compound Name | 2-methyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrrole |
| PubChem CID | 10452199 |
| Molecular Formula | C24H18F3N |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-methyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrrole |
| SMILES | Cc1[nH]c(-c2ccccc2)c(-c2ccccc2)c1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H18F3N/c1-16-21(19-13-8-14-20(15-19)24(25,26)27)22(17-9-4-2-5-10-17)23(28-16)18-11-6-3-7-12-18/h2-15,28H,1H3 |
| InChIKey | UYBIGJBMPPBLIW-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrrole?
The IUPAC name of 2-methyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrrole (CID 10452199) is 2-methyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrrole.
What is the SMILES notation for 2-methyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrrole?
The canonical SMILES for 2-methyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrrole is Cc1[nH]c(-c2ccccc2)c(-c2ccccc2)c1-c1cccc(C(F)(F)F)c1.
What is the InChIKey of 2-methyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrrole?
The InChIKey is UYBIGJBMPPBLIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18F3N/c1-16-21(19-13-8-14-20(15-19)24(25,26)27)22(17-9-4-2-5-10-17)23(28-16)18-11-6-3-7-12-18/h2-15,28H,1H3.
What are the key properties of 2-methyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrrole?
2-methyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrrole has a molecular weight of 377.41 g/mol, XLogP of 7.34, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-1H-pyrrole is sourced from PubChem (CID 10452199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).