C12H22ClNO3S — CID 104522223
N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-2-carboxamide (PubChem CID 104522223) has the molecular formula C12H22ClNO3S and a molecular weight of 295.83 g/mol. Its IUPAC name is N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-2-carboxamide.
| Compound Name | N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-2-carboxamide |
|---|---|
| PubChem CID | 104522223 |
| Molecular Formula | C12H22ClNO3S |
| Molecular Weight | 295.83 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-2-carboxamide |
| SMILES | CC(C)N(CCCCl)C(=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C12H22ClNO3S/c1-10(2)14(8-5-7-13)12(15)11-6-3-4-9-18(11,16)17/h10-11H,3-9H2,1-2H3 |
| InChIKey | UPSJPICCVVOBDZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.83 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|