About N-(2-chloroethyl)-1,1-dioxo-N-propylthiane-2-carboxamide
N-(2-chloroethyl)-1,1-dioxo-N-propylthiane-2-carboxamide (PubChem CID 104522242) has the molecular formula C11H20ClNO3S
and a molecular weight of 281.80 g/mol. Its IUPAC name is N-(2-chloroethyl)-1,1-dioxo-N-propylthiane-2-carboxamide.
Molecular Properties
| Compound Name | N-(2-chloroethyl)-1,1-dioxo-N-propylthiane-2-carboxamide |
| PubChem CID | 104522242 |
| Molecular Formula | C11H20ClNO3S |
| Molecular Weight | 281.80 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | N-(2-chloroethyl)-1,1-dioxo-N-propylthiane-2-carboxamide |
| SMILES | CCCN(CCCl)C(=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C11H20ClNO3S/c1-2-7-13(8-6-12)11(14)10-5-3-4-9-17(10,15)16/h10H,2-9H2,1H3 |
| InChIKey | WBLQNPDONPVOQI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.80 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloroethyl)-1,1-dioxo-N-propylthiane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloroethyl)-1,1-dioxo-N-propylthiane-2-carboxamide?
The IUPAC name of N-(2-chloroethyl)-1,1-dioxo-N-propylthiane-2-carboxamide (CID 104522242) is N-(2-chloroethyl)-1,1-dioxo-N-propylthiane-2-carboxamide.
What is the SMILES notation for N-(2-chloroethyl)-1,1-dioxo-N-propylthiane-2-carboxamide?
The canonical SMILES for N-(2-chloroethyl)-1,1-dioxo-N-propylthiane-2-carboxamide is CCCN(CCCl)C(=O)C1CCCCS1(=O)=O.
What is the InChIKey of N-(2-chloroethyl)-1,1-dioxo-N-propylthiane-2-carboxamide?
The InChIKey is WBLQNPDONPVOQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20ClNO3S/c1-2-7-13(8-6-12)11(14)10-5-3-4-9-17(10,15)16/h10H,2-9H2,1H3.
What are the key properties of N-(2-chloroethyl)-1,1-dioxo-N-propylthiane-2-carboxamide?
N-(2-chloroethyl)-1,1-dioxo-N-propylthiane-2-carboxamide has a molecular weight of 281.80 g/mol, XLogP of 1.43, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloroethyl)-1,1-dioxo-N-propylthiane-2-carboxamide is sourced from PubChem (CID 104522242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).