C12H22BrNO3S — CID 104522425
N-[1-(bromomethyl)-3-methylcyclohexyl]-2-methylsulfonylpropanamide (PubChem CID 104522425) has the molecular formula C12H22BrNO3S and a molecular weight of 340.28 g/mol. Its IUPAC name is N-[1-(bromomethyl)-3-methylcyclohexyl]-2-methylsulfonylpropanamide.
| Compound Name | N-[1-(bromomethyl)-3-methylcyclohexyl]-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 104522425 |
| Molecular Formula | C12H22BrNO3S |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | N-[1-(bromomethyl)-3-methylcyclohexyl]-2-methylsulfonylpropanamide |
| SMILES | CC1CCCC(CBr)(NC(=O)C(C)S(C)(=O)=O)C1 |
| InChI | InChI=1S/C12H22BrNO3S/c1-9-5-4-6-12(7-9,8-13)14-11(15)10(2)18(3,16)17/h9-10H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | KUMLXXAATDOLMF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|