About 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoic acid
2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoic acid (PubChem CID 10452249) has the molecular formula C20H14N2O4S
and a molecular weight of 378.41 g/mol. Its IUPAC name is 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoic acid |
| PubChem CID | 10452249 |
| Molecular Formula | C20H14N2O4S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoic acid |
| SMILES | O=C(Nc1nccs1)c1ccc(/C=C/C(=O)c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C20H14N2O4S/c23-17(15-3-1-2-4-16(15)19(25)26)10-7-13-5-8-14(9-6-13)18(24)22-20-21-11-12-27-20/h1-12H,(H,25,26)(H,21,22,24)/b10-7+ |
| InChIKey | IIIMTHLXBXTBGW-JXMROGBWSA-N |
| XLogP | 3.99 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoic acid?
The IUPAC name of 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoic acid (CID 10452249) is 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoic acid.
What is the SMILES notation for 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoic acid?
The canonical SMILES for 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoic acid is O=C(Nc1nccs1)c1ccc(/C=C/C(=O)c2ccccc2C(=O)O)cc1.
What is the InChIKey of 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoic acid?
The InChIKey is IIIMTHLXBXTBGW-JXMROGBWSA-N. The full InChI is InChI=1S/C20H14N2O4S/c23-17(15-3-1-2-4-16(15)19(25)26)10-7-13-5-8-14(9-6-13)18(24)22-20-21-11-12-27-20/h1-12H,(H,25,26)(H,21,22,24)/b10-7+.
What are the key properties of 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoic acid?
2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoic acid has a molecular weight of 378.41 g/mol, XLogP of 3.99, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoic acid is sourced from PubChem (CID 10452249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).