C21H27ClO4 — CID 10452283
[(1S,3aS,4S,5S,7aS)-4-(2-chloro-2-oxoethyl)-5-(4-methoxyphenyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl] acetate (PubChem CID 10452283) has the molecular formula C21H27ClO4 and a molecular weight of 378.90 g/mol. Its IUPAC name is [(1S,3aS,4S,5S,7aS)-4-(2-chloro-2-oxoethyl)-5-(4-methoxyphenyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl] acetate.
| Compound Name | [(1S,3aS,4S,5S,7aS)-4-(2-chloro-2-oxoethyl)-5-(4-methoxyphenyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl] acetate |
|---|---|
| PubChem CID | 10452283 |
| Molecular Formula | C21H27ClO4 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [(1S,3aS,4S,5S,7aS)-4-(2-chloro-2-oxoethyl)-5-(4-methoxyphenyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl] acetate |
| SMILES | COc1ccc([C@H]2CC[C@]3(C)[C@@H](OC(C)=O)CC[C@H]3[C@H]2CC(=O)Cl)cc1 |
| InChI | InChI=1S/C21H27ClO4/c1-13(23)26-19-9-8-18-17(12-20(22)24)16(10-11-21(18,19)2)14-4-6-15(25-3)7-5-14/h4-7,16-19H,8-12H2,1-3H3/t16-,17+,18+,19+,21+/m1/s1 |
| InChIKey | ZXCBADJCPASGMH-PWIGDYEPSA-N |
| XLogP | 4.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|