About 5-(1-methylsulfonylethyl)-4-propyl-1,2,4-triazole-3-sulfonyl chloride
5-(1-methylsulfonylethyl)-4-propyl-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 104523111) has the molecular formula C8H14ClN3O4S2
and a molecular weight of 315.80 g/mol. Its IUPAC name is 5-(1-methylsulfonylethyl)-4-propyl-1,2,4-triazole-3-sulfonyl chloride.
Molecular Properties
| Compound Name | 5-(1-methylsulfonylethyl)-4-propyl-1,2,4-triazole-3-sulfonyl chloride |
| PubChem CID | 104523111 |
| Molecular Formula | C8H14ClN3O4S2 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 5-(1-methylsulfonylethyl)-4-propyl-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | CCCn1c(C(C)S(C)(=O)=O)nnc1S(=O)(=O)Cl |
| InChI | InChI=1S/C8H14ClN3O4S2/c1-4-5-12-7(6(2)17(3,13)14)10-11-8(12)18(9,15)16/h6H,4-5H2,1-3H3 |
| InChIKey | LSICDOAHWCODAJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 98.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(1-methylsulfonylethyl)-4-propyl-1,2,4-triazole-3-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-methylsulfonylethyl)-4-propyl-1,2,4-triazole-3-sulfonyl chloride?
The IUPAC name of 5-(1-methylsulfonylethyl)-4-propyl-1,2,4-triazole-3-sulfonyl chloride (CID 104523111) is 5-(1-methylsulfonylethyl)-4-propyl-1,2,4-triazole-3-sulfonyl chloride.
What is the SMILES notation for 5-(1-methylsulfonylethyl)-4-propyl-1,2,4-triazole-3-sulfonyl chloride?
The canonical SMILES for 5-(1-methylsulfonylethyl)-4-propyl-1,2,4-triazole-3-sulfonyl chloride is CCCn1c(C(C)S(C)(=O)=O)nnc1S(=O)(=O)Cl.
What is the InChIKey of 5-(1-methylsulfonylethyl)-4-propyl-1,2,4-triazole-3-sulfonyl chloride?
The InChIKey is LSICDOAHWCODAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14ClN3O4S2/c1-4-5-12-7(6(2)17(3,13)14)10-11-8(12)18(9,15)16/h6H,4-5H2,1-3H3.
What are the key properties of 5-(1-methylsulfonylethyl)-4-propyl-1,2,4-triazole-3-sulfonyl chloride?
5-(1-methylsulfonylethyl)-4-propyl-1,2,4-triazole-3-sulfonyl chloride has a molecular weight of 315.80 g/mol, XLogP of 0.72, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-methylsulfonylethyl)-4-propyl-1,2,4-triazole-3-sulfonyl chloride is sourced from PubChem (CID 104523111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).