C10H10F5NO — CID 104523383
2-methyl-2-(2,3,4,5,6-pentafluorophenoxy)propan-1-amine (PubChem CID 104523383) has the molecular formula C10H10F5NO and a molecular weight of 255.19 g/mol. Its IUPAC name is 2-methyl-2-(2,3,4,5,6-pentafluorophenoxy)propan-1-amine.
| Compound Name | 2-methyl-2-(2,3,4,5,6-pentafluorophenoxy)propan-1-amine |
|---|---|
| PubChem CID | 104523383 |
| Molecular Formula | C10H10F5NO |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-methyl-2-(2,3,4,5,6-pentafluorophenoxy)propan-1-amine |
| SMILES | CC(C)(CN)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H10F5NO/c1-10(2,3-16)17-9-7(14)5(12)4(11)6(13)8(9)15/h3,16H2,1-2H3 |
| InChIKey | DNARWRIJVVLJJZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|