About 9-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one
9-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one (PubChem CID 104523553) has the molecular formula C9H7BrFNO2
and a molecular weight of 260.06 g/mol. Its IUPAC name is 9-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
Molecular Properties
| Compound Name | 9-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| PubChem CID | 104523553 |
| Molecular Formula | C9H7BrFNO2 |
| Molecular Weight | 260.06 g/mol |
| Exact Mass | 258.96 |
| IUPAC Name | 9-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| SMILES | O=C1NCCOc2c(Br)cc(F)cc21 |
| InChI | InChI=1S/C9H7BrFNO2/c10-7-4-5(11)3-6-8(7)14-2-1-12-9(6)13/h3-4H,1-2H2,(H,12,13) |
| InChIKey | MDIPKBCLWWXDLY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.06 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
The IUPAC name of 9-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one (CID 104523553) is 9-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
What is the SMILES notation for 9-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
The canonical SMILES for 9-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one is O=C1NCCOc2c(Br)cc(F)cc21.
What is the InChIKey of 9-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
The InChIKey is MDIPKBCLWWXDLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrFNO2/c10-7-4-5(11)3-6-8(7)14-2-1-12-9(6)13/h3-4H,1-2H2,(H,12,13).
What are the key properties of 9-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
9-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one has a molecular weight of 260.06 g/mol, XLogP of 1.71, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one is sourced from PubChem (CID 104523553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).