C14H23N9S2 — CID 10452458
1-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine (PubChem CID 10452458) has the molecular formula C14H23N9S2 and a molecular weight of 381.54 g/mol. Its IUPAC name is 1-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine.
| Compound Name | 1-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine |
|---|---|
| PubChem CID | 10452458 |
| Molecular Formula | C14H23N9S2 |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 1-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine |
| SMILES | NC(N)=Nc1nc(CSCCN/C(N)=N/CCCc2cnc[nH]2)cs1 |
| InChI | InChI=1S/C14H23N9S2/c15-12(16)23-14-22-11(8-25-14)7-24-5-4-20-13(17)19-3-1-2-10-6-18-9-21-10/h6,8-9H,1-5,7H2,(H,18,21)(H3,17,19,20)(H4,15,16,22,23) |
| InChIKey | SDSBSDJISPODJX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|