About 3-methyl-1'-(2-methylpropyl)spiro[2,3-dihydrochromene-4,5'-4H-imidazole]-2'-amine
3-methyl-1'-(2-methylpropyl)spiro[2,3-dihydrochromene-4,5'-4H-imidazole]-2'-amine (PubChem CID 104524950) has the molecular formula C16H23N3O
and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-methyl-1'-(2-methylpropyl)spiro[2,3-dihydrochromene-4,5'-4H-imidazole]-2'-amine.
Molecular Properties
| Compound Name | 3-methyl-1'-(2-methylpropyl)spiro[2,3-dihydrochromene-4,5'-4H-imidazole]-2'-amine |
| PubChem CID | 104524950 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 3-methyl-1'-(2-methylpropyl)spiro[2,3-dihydrochromene-4,5'-4H-imidazole]-2'-amine |
| SMILES | CC(C)CN1C(N)=NCC12c1ccccc1OCC2C |
| InChI | InChI=1S/C16H23N3O/c1-11(2)8-19-15(17)18-10-16(19)12(3)9-20-14-7-5-4-6-13(14)16/h4-7,11-12H,8-10H2,1-3H3,(H2,17,18) |
| InChIKey | KGTYPLMMXXZXQG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-1'-(2-methylpropyl)spiro[2,3-dihydrochromene-4,5'-4H-imidazole]-2'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1'-(2-methylpropyl)spiro[2,3-dihydrochromene-4,5'-4H-imidazole]-2'-amine?
The IUPAC name of 3-methyl-1'-(2-methylpropyl)spiro[2,3-dihydrochromene-4,5'-4H-imidazole]-2'-amine (CID 104524950) is 3-methyl-1'-(2-methylpropyl)spiro[2,3-dihydrochromene-4,5'-4H-imidazole]-2'-amine.
What is the SMILES notation for 3-methyl-1'-(2-methylpropyl)spiro[2,3-dihydrochromene-4,5'-4H-imidazole]-2'-amine?
The canonical SMILES for 3-methyl-1'-(2-methylpropyl)spiro[2,3-dihydrochromene-4,5'-4H-imidazole]-2'-amine is CC(C)CN1C(N)=NCC12c1ccccc1OCC2C.
What is the InChIKey of 3-methyl-1'-(2-methylpropyl)spiro[2,3-dihydrochromene-4,5'-4H-imidazole]-2'-amine?
The InChIKey is KGTYPLMMXXZXQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O/c1-11(2)8-19-15(17)18-10-16(19)12(3)9-20-14-7-5-4-6-13(14)16/h4-7,11-12H,8-10H2,1-3H3,(H2,17,18).
What are the key properties of 3-methyl-1'-(2-methylpropyl)spiro[2,3-dihydrochromene-4,5'-4H-imidazole]-2'-amine?
3-methyl-1'-(2-methylpropyl)spiro[2,3-dihydrochromene-4,5'-4H-imidazole]-2'-amine has a molecular weight of 273.38 g/mol, XLogP of 2.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1'-(2-methylpropyl)spiro[2,3-dihydrochromene-4,5'-4H-imidazole]-2'-amine is sourced from PubChem (CID 104524950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).