C20H20N2O6 — CID 10452587
methyl 3-(4-amino-1,3-dioxoisoindol-2-yl)-3-(3,4-dimethoxyphenyl)propanoate (PubChem CID 10452587) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is methyl 3-(4-amino-1,3-dioxoisoindol-2-yl)-3-(3,4-dimethoxyphenyl)propanoate.
| Compound Name | methyl 3-(4-amino-1,3-dioxoisoindol-2-yl)-3-(3,4-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 10452587 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | methyl 3-(4-amino-1,3-dioxoisoindol-2-yl)-3-(3,4-dimethoxyphenyl)propanoate |
| SMILES | COC(=O)CC(c1ccc(OC)c(OC)c1)N1C(=O)c2cccc(N)c2C1=O |
| InChI | InChI=1S/C20H20N2O6/c1-26-15-8-7-11(9-16(15)27-2)14(10-17(23)28-3)22-19(24)12-5-4-6-13(21)18(12)20(22)25/h4-9,14H,10,21H2,1-3H3 |
| InChIKey | UHHZKWNCNDFRNB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|