C18H13ClN4O2S — CID 10452640
2-chloro-N-[1-(cyanomethyl)-2-oxo-3,4-dihydroquinolin-3-yl]-6H-thieno[2,3-b]pyrrole-5-carboxamide (PubChem CID 10452640) has the molecular formula C18H13ClN4O2S and a molecular weight of 384.85 g/mol. Its IUPAC name is 2-chloro-N-[1-(cyanomethyl)-2-oxo-3,4-dihydroquinolin-3-yl]-6H-thieno[2,3-b]pyrrole-5-carboxamide.
| Compound Name | 2-chloro-N-[1-(cyanomethyl)-2-oxo-3,4-dihydroquinolin-3-yl]-6H-thieno[2,3-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 10452640 |
| Molecular Formula | C18H13ClN4O2S |
| Molecular Weight | 384.85 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 2-chloro-N-[1-(cyanomethyl)-2-oxo-3,4-dihydroquinolin-3-yl]-6H-thieno[2,3-b]pyrrole-5-carboxamide |
| SMILES | N#CCN1C(=O)C(NC(=O)c2cc3cc(Cl)sc3[nH]2)Cc2ccccc21 |
| InChI | InChI=1S/C18H13ClN4O2S/c19-15-9-11-8-12(22-17(11)26-15)16(24)21-13-7-10-3-1-2-4-14(10)23(6-5-20)18(13)25/h1-4,8-9,13,22H,6-7H2,(H,21,24) |
| InChIKey | FBJSJDCYJIMOOH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.85 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|