C13H18N2S — CID 104526761
1-methyl-N-(thiolan-3-yl)-2,3-dihydroindol-6-amine (PubChem CID 104526761) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 1-methyl-N-(thiolan-3-yl)-2,3-dihydroindol-6-amine.
| Compound Name | 1-methyl-N-(thiolan-3-yl)-2,3-dihydroindol-6-amine |
|---|---|
| PubChem CID | 104526761 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1-methyl-N-(thiolan-3-yl)-2,3-dihydroindol-6-amine |
| SMILES | CN1CCc2ccc(NC3CCSC3)cc21 |
| InChI | InChI=1S/C13H18N2S/c1-15-6-4-10-2-3-11(8-13(10)15)14-12-5-7-16-9-12/h2-3,8,12,14H,4-7,9H2,1H3 |
| InChIKey | KGYRHXQCJPKTAN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |