C22H21F3N2O — CID 10452724
(1R)-N-[[4-methoxy-3-[6-(trifluoromethyl)-3-pyridinyl]phenyl]methyl]-1-phenylethanamine (PubChem CID 10452724) has the molecular formula C22H21F3N2O and a molecular weight of 386.42 g/mol. Its IUPAC name is (1R)-N-[[4-methoxy-3-[6-(trifluoromethyl)-3-pyridinyl]phenyl]methyl]-1-phenylethanamine.
| Compound Name | (1R)-N-[[4-methoxy-3-[6-(trifluoromethyl)-3-pyridinyl]phenyl]methyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 10452724 |
| Molecular Formula | C22H21F3N2O |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (1R)-N-[[4-methoxy-3-[6-(trifluoromethyl)-3-pyridinyl]phenyl]methyl]-1-phenylethanamine |
| SMILES | COc1ccc(CN[C@H](C)c2ccccc2)cc1-c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C22H21F3N2O/c1-15(17-6-4-3-5-7-17)26-13-16-8-10-20(28-2)19(12-16)18-9-11-21(27-14-18)22(23,24)25/h3-12,14-15,26H,13H2,1-2H3/t15-/m1/s1 |
| InChIKey | UGWMKLSZBLVUJS-OAHLLOKOSA-N |
| XLogP | 5.63 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |