C23H32O5 — CID 10452882
methyl (1R,2R,4S,6R,8S,9R,13S,14R,17R)-4-ethoxy-9,13-dimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadeca-10,15-diene-17-carboxylate (PubChem CID 10452882) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is methyl (1R,2R,4S,6R,8S,9R,13S,14R,17R)-4-ethoxy-9,13-dimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadeca-10,15-diene-17-carboxylate.
| Compound Name | methyl (1R,2R,4S,6R,8S,9R,13S,14R,17R)-4-ethoxy-9,13-dimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadeca-10,15-diene-17-carboxylate |
|---|---|
| PubChem CID | 10452882 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | methyl (1R,2R,4S,6R,8S,9R,13S,14R,17R)-4-ethoxy-9,13-dimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadeca-10,15-diene-17-carboxylate |
| SMILES | CCO[C@@H]1C[C@@H]2[C@@]34CO[C@]2(C(=O)OC)C=C[C@@H]3[C@@]2(C)CC=C[C@@H](C)[C@@H]2C[C@H]4O1 |
| InChI | InChI=1S/C23H32O5/c1-5-26-19-12-17-22-13-27-23(17,20(24)25-4)10-8-16(22)21(3)9-6-7-14(2)15(21)11-18(22)28-19/h6-8,10,14-19H,5,9,11-13H2,1-4H3/t14-,15+,16-,17-,18-,19+,21+,22-,23-/m1/s1 |
| InChIKey | UMAHHXBLUNBZCE-OXLNJSLFSA-N |
| XLogP | 3.49 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|