C24H31N5 — CID 10452955
2-methyl-3-[2-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]ethyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-amine (PubChem CID 10452955) has the molecular formula C24H31N5 and a molecular weight of 389.55 g/mol. Its IUPAC name is 2-methyl-3-[2-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]ethyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-amine.
| Compound Name | 2-methyl-3-[2-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]ethyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-amine |
|---|---|
| PubChem CID | 10452955 |
| Molecular Formula | C24H31N5 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | 2-methyl-3-[2-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]ethyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-amine |
| SMILES | Cc1ccnc(N2CCN(CCc3c(C)n4c5c(cc(N)cc35)CCC4)CC2)c1 |
| InChI | InChI=1S/C24H31N5/c1-17-5-7-26-23(14-17)28-12-10-27(11-13-28)9-6-21-18(2)29-8-3-4-19-15-20(25)16-22(21)24(19)29/h5,7,14-16H,3-4,6,8-13,25H2,1-2H3 |
| InChIKey | JZXGLJFJTCZMCD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|