C10H18F3NS — CID 104531021
3,3-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclopentan-1-amine (PubChem CID 104531021) has the molecular formula C10H18F3NS and a molecular weight of 241.32 g/mol. Its IUPAC name is 3,3-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclopentan-1-amine.
| Compound Name | 3,3-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 104531021 |
| Molecular Formula | C10H18F3NS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 3,3-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclopentan-1-amine |
| SMILES | CC1(C)CCC(NCCSC(F)(F)F)C1 |
| InChI | InChI=1S/C10H18F3NS/c1-9(2)4-3-8(7-9)14-5-6-15-10(11,12)13/h8,14H,3-7H2,1-2H3 |
| InChIKey | GNJFKKCXFKGUCA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|