C14H27NO — CID 104531141
N-[2-(cyclopropylmethoxy)ethyl]-2,4-dimethylcyclohexan-1-amine (PubChem CID 104531141) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is N-[2-(cyclopropylmethoxy)ethyl]-2,4-dimethylcyclohexan-1-amine.
| Compound Name | N-[2-(cyclopropylmethoxy)ethyl]-2,4-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 104531141 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | N-[2-(cyclopropylmethoxy)ethyl]-2,4-dimethylcyclohexan-1-amine |
| SMILES | CC1CCC(NCCOCC2CC2)C(C)C1 |
| InChI | InChI=1S/C14H27NO/c1-11-3-6-14(12(2)9-11)15-7-8-16-10-13-4-5-13/h11-15H,3-10H2,1-2H3 |
| InChIKey | WNTWAFSGRMNFBX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|