C16H14Cl2N6O2 — CID 10453166
2-(3-chloro-1-hydroxy-6-imino-2-pyridinyl)-N-[[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]acetamide (PubChem CID 10453166) has the molecular formula C16H14Cl2N6O2 and a molecular weight of 393.23 g/mol. Its IUPAC name is 2-(3-chloro-1-hydroxy-6-imino-2-pyridinyl)-N-[[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]acetamide.
| Compound Name | 2-(3-chloro-1-hydroxy-6-imino-2-pyridinyl)-N-[[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 10453166 |
| Molecular Formula | C16H14Cl2N6O2 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 2-(3-chloro-1-hydroxy-6-imino-2-pyridinyl)-N-[[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]acetamide |
| SMILES | [H]/N=c1\ccc(Cl)c(CC(=O)NCc2cc(Cl)ccc2-n2cncn2)n1O |
| InChI | InChI=1S/C16H14Cl2N6O2/c17-11-1-3-13(23-9-20-8-22-23)10(5-11)7-21-16(25)6-14-12(18)2-4-15(19)24(14)26/h1-5,8-9,19,26H,6-7H2,(H,21,25)/b19-15+ |
| InChIKey | IJFVCSIIFDEQPX-XDJHFCHBSA-N |
| XLogP | 1.95 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|