About (4-fluorophenyl)methyl 3-benzyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate
(4-fluorophenyl)methyl 3-benzyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate (PubChem CID 10453178) has the molecular formula C22H20FN3O3
and a molecular weight of 393.42 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 3-benzyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | (4-fluorophenyl)methyl 3-benzyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate |
| PubChem CID | 10453178 |
| Molecular Formula | C22H20FN3O3 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (4-fluorophenyl)methyl 3-benzyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate |
| SMILES | O=C(OCc1ccc(F)cc1)N1CCc2ncn(Cc3ccccc3)c(=O)c2C1 |
| InChI | InChI=1S/C22H20FN3O3/c23-18-8-6-17(7-9-18)14-29-22(28)25-11-10-20-19(13-25)21(27)26(15-24-20)12-16-4-2-1-3-5-16/h1-9,15H,10-14H2 |
| InChIKey | SVPGMSQVXSLHGD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-fluorophenyl)methyl 3-benzyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)methyl 3-benzyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate?
The IUPAC name of (4-fluorophenyl)methyl 3-benzyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate (CID 10453178) is (4-fluorophenyl)methyl 3-benzyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate.
What is the SMILES notation for (4-fluorophenyl)methyl 3-benzyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate?
The canonical SMILES for (4-fluorophenyl)methyl 3-benzyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate is O=C(OCc1ccc(F)cc1)N1CCc2ncn(Cc3ccccc3)c(=O)c2C1.
What is the InChIKey of (4-fluorophenyl)methyl 3-benzyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate?
The InChIKey is SVPGMSQVXSLHGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20FN3O3/c23-18-8-6-17(7-9-18)14-29-22(28)25-11-10-20-19(13-25)21(27)26(15-24-20)12-16-4-2-1-3-5-16/h1-9,15H,10-14H2.
What are the key properties of (4-fluorophenyl)methyl 3-benzyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate?
(4-fluorophenyl)methyl 3-benzyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate has a molecular weight of 393.42 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl 3-benzyl-4-oxo-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate is sourced from PubChem (CID 10453178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).