C12H21N3 — CID 104532476
3-N-methyl-5-N,5-N-dipropylpyridine-3,5-diamine (PubChem CID 104532476) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-N-methyl-5-N,5-N-dipropylpyridine-3,5-diamine.
| Compound Name | 3-N-methyl-5-N,5-N-dipropylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 104532476 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 3-N-methyl-5-N,5-N-dipropylpyridine-3,5-diamine |
| SMILES | CCCN(CCC)c1cncc(NC)c1 |
| InChI | InChI=1S/C12H21N3/c1-4-6-15(7-5-2)12-8-11(13-3)9-14-10-12/h8-10,13H,4-7H2,1-3H3 |
| InChIKey | DSMKKECUQBVOCG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |