C22H26N2O3Si — CID 10453255
(3aS,4S,6aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3a,4,6a-tetrahydrofuro[3,4-c]pyrazol-6-one (PubChem CID 10453255) has the molecular formula C22H26N2O3Si and a molecular weight of 394.55 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3a,4,6a-tetrahydrofuro[3,4-c]pyrazol-6-one.
| Compound Name | (3aS,4S,6aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3a,4,6a-tetrahydrofuro[3,4-c]pyrazol-6-one |
|---|---|
| PubChem CID | 10453255 |
| Molecular Formula | C22H26N2O3Si |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (3aS,4S,6aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3a,4,6a-tetrahydrofuro[3,4-c]pyrazol-6-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1OC(=O)[C@@H]2N=NC[C@H]12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O3Si/c1-22(2,3)28(16-10-6-4-7-11-16,17-12-8-5-9-13-17)26-15-19-18-14-23-24-20(18)21(25)27-19/h4-13,18-20H,14-15H2,1-3H3/t18-,19-,20-/m1/s1 |
| InChIKey | FQESPLQIERDWGH-VAMGGRTRSA-N |
| XLogP | 2.94 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|