C13H19N3 — CID 104533509
5-N-(dicyclopropylmethyl)-3-N-methylpyridine-3,5-diamine (PubChem CID 104533509) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 5-N-(dicyclopropylmethyl)-3-N-methylpyridine-3,5-diamine.
| Compound Name | 5-N-(dicyclopropylmethyl)-3-N-methylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 104533509 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 5-N-(dicyclopropylmethyl)-3-N-methylpyridine-3,5-diamine |
| SMILES | CNc1cncc(NC(C2CC2)C2CC2)c1 |
| InChI | InChI=1S/C13H19N3/c1-14-11-6-12(8-15-7-11)16-13(9-2-3-9)10-4-5-10/h6-10,13-14,16H,2-5H2,1H3 |
| InChIKey | DYBWHXMNQWVMIS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |