C12H21N3O — CID 104534908
3-N-ethyl-5-N-(4-methoxybutan-2-yl)pyridine-3,5-diamine (PubChem CID 104534908) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-N-ethyl-5-N-(4-methoxybutan-2-yl)pyridine-3,5-diamine.
| Compound Name | 3-N-ethyl-5-N-(4-methoxybutan-2-yl)pyridine-3,5-diamine |
|---|---|
| PubChem CID | 104534908 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 3-N-ethyl-5-N-(4-methoxybutan-2-yl)pyridine-3,5-diamine |
| SMILES | CCNc1cncc(NC(C)CCOC)c1 |
| InChI | InChI=1S/C12H21N3O/c1-4-14-11-7-12(9-13-8-11)15-10(2)5-6-16-3/h7-10,14-15H,4-6H2,1-3H3 |
| InChIKey | UUTQVWCAIOBQPE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |