About 4-[5-(propylamino)-3-pyridinyl]-1,4-diazepan-2-one
4-[5-(propylamino)-3-pyridinyl]-1,4-diazepan-2-one (PubChem CID 104535015) has the molecular formula C13H20N4O
and a molecular weight of 248.33 g/mol. Its IUPAC name is 4-[5-(propylamino)-3-pyridinyl]-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 4-[5-(propylamino)-3-pyridinyl]-1,4-diazepan-2-one |
| PubChem CID | 104535015 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 4-[5-(propylamino)-3-pyridinyl]-1,4-diazepan-2-one |
| SMILES | CCCNc1cncc(N2CCCNC(=O)C2)c1 |
| InChI | InChI=1S/C13H20N4O/c1-2-4-15-11-7-12(9-14-8-11)17-6-3-5-16-13(18)10-17/h7-9,15H,2-6,10H2,1H3,(H,16,18) |
| InChIKey | MKOUCVXLOROSPU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[5-(propylamino)-3-pyridinyl]-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(propylamino)-3-pyridinyl]-1,4-diazepan-2-one?
The IUPAC name of 4-[5-(propylamino)-3-pyridinyl]-1,4-diazepan-2-one (CID 104535015) is 4-[5-(propylamino)-3-pyridinyl]-1,4-diazepan-2-one.
What is the SMILES notation for 4-[5-(propylamino)-3-pyridinyl]-1,4-diazepan-2-one?
The canonical SMILES for 4-[5-(propylamino)-3-pyridinyl]-1,4-diazepan-2-one is CCCNc1cncc(N2CCCNC(=O)C2)c1.
What is the InChIKey of 4-[5-(propylamino)-3-pyridinyl]-1,4-diazepan-2-one?
The InChIKey is MKOUCVXLOROSPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O/c1-2-4-15-11-7-12(9-14-8-11)17-6-3-5-16-13(18)10-17/h7-9,15H,2-6,10H2,1H3,(H,16,18).
What are the key properties of 4-[5-(propylamino)-3-pyridinyl]-1,4-diazepan-2-one?
4-[5-(propylamino)-3-pyridinyl]-1,4-diazepan-2-one has a molecular weight of 248.33 g/mol, XLogP of 1.23, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(propylamino)-3-pyridinyl]-1,4-diazepan-2-one is sourced from PubChem (CID 104535015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).