C15H24N4 — CID 104535461
N-methyl-5-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyridin-3-amine (PubChem CID 104535461) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is N-methyl-5-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyridin-3-amine.
| Compound Name | N-methyl-5-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 104535461 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | N-methyl-5-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyridin-3-amine |
| SMILES | CNc1cncc(N2CCC3C(CCCN3C)C2)c1 |
| InChI | InChI=1S/C15H24N4/c1-16-13-8-14(10-17-9-13)19-7-5-15-12(11-19)4-3-6-18(15)2/h8-10,12,15-16H,3-7,11H2,1-2H3 |
| InChIKey | JMKQKKCIOSRBPK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |