C12H18N4O2 — CID 104535677
N-methyl-4-[5-(methylamino)-3-pyridinyl]morpholine-3-carboxamide (PubChem CID 104535677) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is N-methyl-4-[5-(methylamino)-3-pyridinyl]morpholine-3-carboxamide.
| Compound Name | N-methyl-4-[5-(methylamino)-3-pyridinyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 104535677 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N-methyl-4-[5-(methylamino)-3-pyridinyl]morpholine-3-carboxamide |
| SMILES | CNC(=O)C1COCCN1c1cncc(NC)c1 |
| InChI | InChI=1S/C12H18N4O2/c1-13-9-5-10(7-15-6-9)16-3-4-18-8-11(16)12(17)14-2/h5-7,11,13H,3-4,8H2,1-2H3,(H,14,17) |
| InChIKey | SSWDUKVQZBYVOH-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |